Current location - Training Enrollment Network - Mathematics courses - Eight answers to math weekend homework
Eight answers to math weekend homework
Comprehensive set of chemical equations in grade three-refining requirements

-

Summary of Chemical Equation in Grade Three (Unit 1-7)

combination reaction

1. Magnesium burns in air: 2Mg+O2 ignites 2MgO.

2. Iron burns in oxygen: 3Fe+2O2 ignites Fe3O4.

3. Aluminum burns in air: 4Al+3O2 ignites 2Al2O3.

4. Hydrogen burns in air: 2H2+O2 ignites 2H2O.

5. Red phosphorus burns in air: 4P+5O2 ignites 2P2O5.

6. Sulfur powder burns in air: S+O2 ignites SO2.

7. Complete combustion of carbon in oxygen: C+O2 ignites CO2.

8. Incomplete combustion of carbon in oxygen: 2C+O2 ignites 2CO.

9. Carbon dioxide passes through the hot carbon layer: C+CO2, high temperature 2CO.

10. Carbon monoxide burns in oxygen: 2CO+O2 ignites 2CO2.

1 1. Reaction of carbon dioxide with water (carbon dioxide is introduced into litmus purpurea test solution): CO2+H2O === H2CO3.

12, quicklime dissolved in water: CaO+H2O === Ca(OH)2.

13, anhydrous copper sulfate as desiccant: cuso 4+5H2O = = = = cuso 4·5H2O.

14. Sodium burns in chlorine: 2Na+Cl2 ignites 2NaCl.

decomposition reaction

15, oxygen production with hydrogen peroxide in the laboratory: 2H2O2 MnO2 2H2O+ O2↑ =

16, heating potassium permanganate: 2KMnO4 heating k2mno4+MnO2+O2 =

17, water decomposition under the action of direct current: 2H2O charged 2H2 =+O2 =

18, unstable decomposition of carbonic acid: H2CO3 === H2O+CO2↑ = =

19. Calcined limestone at high temperature (industrial preparation method of carbon dioxide): CaCO3, high temperature CaO+CO2↑ =

displacement reaction

20. The reaction between iron and copper sulfate solution: Fe+CuSO4 == FeSO4+Cu.

2 1, reaction of zinc with dilute sulfuric acid (hydrogen production in laboratory): Zn+Zn+H2SO4 == ZnSO4+H2↑ =

22. the reaction of magnesium with dilute hydrochloric acid: mg Mg+ 2HCl === MgCl2+H2↑ =

23. Reduction of copper oxide by hydrogen: H2+ copper oxide heats copper +H2O.

24. Reduction of copper oxide with charcoal: 2Cu, high temperature 2Cu+CO2↑ =

25. Methane burns in air: CH4+2O2 ignites CO2+2H2O.

26. Water vapor passes through the hot carbon layer: H2+CO+C, high temperature H2+Co.

27. Reduction of iron oxide by coke: 3C+ 2Fe2O3, high temperature 4Fe+3CO2↑ =

other

28. The reaction between sodium hydroxide solution and copper sulfate solution: 2NaOH+CuSO4 == Cu(OH)2↓+Na2SO4.

29. Methane burns in air: CH4+2O2 ignites CO2+2H2O.

30. Alcohol burns in the air: C2H5OH+3O2 ignites 2CO2+3H2O.

3 1. Reduction of copper oxide by carbon monoxide: CO+ CuO heats Cu+CO2.

32. Carbon monoxide reduces iron oxide at high temperature: 3CO+ Fe2O3, 2Fe+3CO2.

33. Clarify carbon dioxide (CO2) produced by limewater: Ca (OH) 2+CO2 = = = CaCO3 ↓+H2O+H2O.

34, sodium hydroxide and carbon dioxide reaction (carbon dioxide removal): 2 NaOH+CO2 = = = Na2CO3+H2O.

35. The reaction between limestone (or marble) and dilute hydrochloric acid (carbon dioxide is prepared in the laboratory): CaCO3+2hcl = = CaCl2+H2O+CO2 =

36. The reaction of sodium carbonate with concentrated hydrochloric acid (foam extinguisher's principle): Na2CO3+2HCl = = 2NaCl+H2O+CO2 =

I. Reaction of substances with oxygen:

(1) the reaction of simple substance with oxygen;

1. Magnesium burns in air: 2Mg+O2 ignites 2MgO.

2. Iron burns in oxygen: 3Fe+2O2 ignites Fe3O4.

3. Copper heating in air: 2Cu+O2 heating 2CuO.

4. Aluminum burns in air: 4Al+3O2 ignites 2Al2O3.

5. Combustion in hydrogen and air: 2H2+O2 ignites 2H2O.

6. Red phosphorus burns in air: 4P+5O2 ignites 2P2O5.

7. Sulfur powder burns in air: S+O2 ignites SO2.

8. Complete combustion of carbon in oxygen: C+O2 ignites CO2.

9. Incomplete combustion of carbon in oxygen: 2C+O2 ignites 2CO.

(2) the reaction of compounds with oxygen:

10. Carbon monoxide burns in oxygen: 2CO+O2 ignites 2CO2.

1 1. Methane burns in air: CH4+2O2 ignites CO2+2H2O.

12. Alcohol burns in air: C2H5OH+3O2 ignites 2CO2+3H2O.

2. Several decomposition reactions:

13. Decomposition of water under direct current: 2H2O charged 2H2 =+O2 =

14. heating basic copper carbonate: Cu2(OH)2CO3 heating 2cuo+H2O+CO2 =

15. heating potassium chlorate (containing a small amount of manganese dioxide): 2kClO3 = = = 2kCl+3o2 =

16. heating potassium permanganate: 2KMnO4 heating k2mno4+MnO2+O2 =

17. Carbonic acid is unstable and decomposed: H2CO3 === H2O+CO2↑ =

18. high temperature calcined limestone: CaCO3, high temperature CaO+CO2↑ =

Three. Several redox reactions:

19. Reduction of copper oxide by hydrogen: H2+ copper oxide heats copper +H2O.

20. Reduction of copper oxide with charcoal: 2Cu, high temperature 2Cu+CO2↑ =

Author: Wang Dong3684 2005-12-310: 08 Reply to this speech.

-

2 Comprehensive set of chemical equations in Grade 3-Require refinement

2 1. Iron oxide reduction by coke: 3C+ 2Fe2O3, high temperature 4Fe+3CO2↑ =

22. Reducing Fe3O4 with coke at high temperature: 2c+Fe3O4, 3Fe+2 CO2 =

23. Reduction of copper oxide by carbon monoxide: CO+ CuO heats Cu+CO2.

24. Reduction of iron oxide by carbon monoxide: 3CO+ Fe2O3, high temperature, 2Fe+3CO2.

25. Reduction of ferroferric oxide with carbon monoxide: 4CO+ Fe3O4, high temperature 3Fe+4CO2.

4. Relationship among simple substance, oxide, acid, alkali and salt

(1) elemental metal+acid salt+hydrogen (displacement reaction)

26. Zinc and dilute sulfuric acid Zn+H2SO4 = ZnSO4+H2 Write

27. Iron and dilute sulfuric acid Fe+H2SO4 = FeSO4+H2 Write

28. magnesium and dilute sulfuric acid mg+H2SO4 = mgso4+H2 write

29. Aluminum and dilute sulfuric acid 2Al +3H2SO4 = Al2(SO4)3 +3H2↑ 3+3H2+3H2 write 3+3H2.

30. Zinc and dilute hydrochloric acid Zn+Zn+2HCl === ZnCl2+H2↑ =

3 1. Iron and dilute hydrochloric acid Fe+2 Fe+2HCl === FeCl2+H2↑ = H2 =

32. Magnesium and dilute hydrochloric acid Mg Mg+ 2HCl === MgCl2+H2↑ =

33. Aluminum and dilute hydrochloric acid 2Al+6HCl = = 2AlCl3+3H2 Write

(2) Simple metal+salt (solution)-another metal+another salt

34. The reaction between iron and copper sulfate solution: Fe+CuSO4 = = FeSO4+Cu.

35. The reaction between zinc and copper sulfate solution: Zn+CuSO4 = = ZnSO4+Cu.

36. The reaction between copper and mercury nitrate solution: Cu+Hg (NO3) 2 = = Cu (NO3) 2+Hg.

(3) Alkaline oxide+acid salt+water

37. The reaction of iron oxide with dilute hydrochloric acid: Fe2O3+6HCl === 2FeCl3+3H2O+3H2O.

38. Reaction of iron oxide with dilute sulfuric acid: Fe2O3+3H2SO4 = = Fe2 (SO4) 3+3H2O+3H2O.

39. Reaction of copper oxide with dilute hydrochloric acid: CuO+2hcl = = = CuCl2+H2O.

40. The reaction between copper oxide and dilute sulfuric acid: CuO+H2SO4 = = = CuSO4+H2O.

4 1. The reaction of magnesium oxide with dilute sulfuric acid: MgO+H2SO4 = = = MgSO4+H2O.

42. The reaction of calcium oxide with dilute hydrochloric acid: Cao+2 HCl = = = CaCl2+H2O.

(4) acidic oxide+alkaline salt+water

43. Caustic sodium will deteriorate when exposed to air: 2NaOH+CO2 ==== Na2CO3+H2O.

44. Caustic sodium absorbs sulfur dioxide gas: 2 NaOH+SO2 = = = Na2SO3+H2O.

45. Caustic sodium absorbs sulfur trioxide gas: 2NaOH+SO3 ==== Na2SO4+H2O.

46. The slaked lime deteriorates in the air: Ca (OH) 2+CO2 = = = CaCO3 ↓+H2O+H2O.

47. The slaked lime absorbs sulfur dioxide: ca (oh) 2+SO2 = = = caso3 ↓+H2O+H2O.

(5) acid+alkali-salt+water

48. Reaction of hydrochloric acid with caustic soda: HCl+NaOH = = = NaCl+H2O.

49. Reaction of hydrochloric acid and potassium hydroxide: HCl+KOH = = = KCl+H2O.

50. The reaction between hydrochloric acid and copper hydroxide: 2HCl+Cu (OH) 2 = = CuCl2+2H2O.

5 1. The reaction between hydrochloric acid and calcium hydroxide: 2hcl+Ca (OH) 2 = = CaCl2+2h2o.

52. The reaction between hydrochloric acid and iron hydroxide: 3HCl+Fe (OH) 3 = = = FeCl 3+3H2O.

53. Aluminum hydroxide for the treatment of hyperacidity: 3HCl+Al (OH) 3 = = = AlCl3+3H2O.

54. Reaction between sulfuric acid and caustic soda: H2SO4+2NaOH = = = Na2SO4+2H2O.

55. The reaction between sulfuric acid and potassium hydroxide: H2SO4+2koh = = = K2SO4+2h2o.

56. The reaction between sulfuric acid and copper hydroxide: H2SO4+Cu (OH) 2 = = CuSO4+2H2O.

57. The reaction between sulfuric acid and iron hydroxide: 3H2SO4+2Fe (OH) 3 = = Fe2 (SO4) 3+6H2O.

58. The reaction between nitric acid and caustic soda: nitric acid+sodium hydroxide = = = sodium nitrite+H2O H2O.

(6) acid+salt-another acid+another salt

59. marble reacts with dilute hydrochloric acid: CaCO3+2hcl = = CaCl2+H2O+CO2 =

60. Sodium carbonate reacts with dilute hydrochloric acid: Na2CO3+2HCl = = 2NaCl+H2O+CO2 =

6 1. Reaction of magnesium carbonate with dilute hydrochloric acid: MgCO3+2HCl = = MgCl2+H2O+CO2 =

62. Reaction between hydrochloric acid and silver nitrate solution: HCl+AgNO3 === AgCl↓+HNO3.

63. The reaction of sulfuric acid and sodium carbonate: Na2CO3+H2SO4 = = Na2SO4+H2O+CO2 =

64. The reaction between sulfuric acid and barium chloride solution: H2SO4+bacl2 = = = baso4 ↓+2hcl.

(7) alkali+salt-another alkali+another salt

65. Sodium hydroxide and copper sulfate: 2 NaOH+CuSO4 = = Cu (OH) 2 ↓+Na2SO4.

66. Sodium hydroxide and ferric chloride: 3 NaOH+FeCl 3 = = Fe (OH) 3 ↓+3 NaCl.

67. Sodium hydroxide and magnesium chloride: 2 NaOH+MgCl2 = = mg (OH) 2 ↓+2 NaCl.

68. Sodium hydroxide and copper chloride: 2 NaOH+CuCl2 = = Cu (OH) 2 ↓+2 NaCl.

69. Calcium hydroxide and sodium carbonate: Ca (OH) 2+Na2CO3 = = CaCO3 ↓+2NaOH.

(8) salt+salt-two new salts

70. Sodium chloride solution and silver nitrate solution: NaCl+AgNO3 = = = AgCl ↓+Nano3.

Author: Wang Dong3684 2005-12-310: 08 Reply to this speech.

-

3 Comprehensive set of chemical equations in Grade 3-Require refinement

7 1. sodium sulfate and barium chloride: Na2SO4+bacl2 = = = baso4 ↓+2 NaCl.

Verb (short for verb) Other reactions:

72. Carbon dioxide is soluble in water: CO2+H2O === H2CO3.

73. Quicklime is soluble in water: CaO+H2O === Ca(OH)2.

74. Sodium oxide is soluble in water: Na2O+H2O = = = 2 NaOH.

75. Sulfur trioxide is soluble in water: SO3+H2O = = = H2SO4.

76. Copper sulfate crystal is decomposed by heating: CuSO4 5H2O heats CuSO4+5H2O.

77. Anhydrous copper sulfate as desiccant: CuSO4+5h2o = = = CuSO4 5h2.

Application of chemical equation reaction phenomenon

2Mg+O2 ignition or Δ 2mog intense combustion, giving off dazzling white light, producing white solids, releasing heat, and producing a large number of white smoke and white signal flares.

Lavoisier experiment of red solid generated by 2Hg+O2 igniting or δδ2Hg o silvery white liquid.

2Cu+O2 ignites or δδ2CuO red metal becomes black solid.

4Al+3O2 ignites or δ△ 2al2o3 silvery white metal becomes a white solid.

3Fe+2O2 ignites Fe3O4, which burns violently and sparks everywhere, producing black solid, releasing 4Fe+3O2 and producing high-temperature 2Fe2O3.

C+O2 ignites CO2 and burns violently, giving off white light and releasing heat, which makes limewater turbid.

S+O2 ignites SO2 to burn violently, which gives off heat and has a pungent smell. There is a light blue flame in the air and a blue-purple flame in the oxygen.

2H2+O2 ignites 2H2O light blue flame, releasing heat to generate liquid (water) high-energy fuel, making anhydrous copper sulfate blue.

4P+5O2 ignites 2P2O5, which burns violently, producing a lot of white smoke, releasing heat and producing white solid, which proves the oxygen content in the air.

CH4+2O2 ignites the blue flame of 2H2O+CO2, releasing heat, producing gas that makes limewater turbid, making anhydrous CuSO4 blue. Combustion of liquid methane and natural gas.

2C2H2+5O2 ignites the blue flame of 2H2O+4CO2, releasing heat and black smoke, producing gas that makes limewater turbid and liquid (water) oxyacetylene flame that makes anhydrous CuSO4 blue, welding and cutting metals.

2kcl3omno2δ 2kcl+3o2 ↑ generated gas to rekindle the wood strips to Mars; Laboratory preparation of oxygen.

2kmno4 Δ k2mno4+MnO2+O2 ↑ purple turns black, and gas is generated to rekindle the wood strips to Mars. Oxygen is prepared in the laboratory.

2HGO Δ 2HG+O2 ↑ turns red into silvery white, producing gas. Mars reburning battens for lavoisier experiment.

2H2O is electrified, and 2H2↑+O2↑ water is electrified and decomposed into hydrogen and oxygen to electrolyze water.

Cu2 (OH) 2co3 δ 2cuo+H2O+CO2 turns green and turns black, and there is liquid on the wall of the test tube, which makes the limewater turbid.

NH4CO3δ NH3 ↑+H2O+CO2 ↑ CO2 ↑ White solid disappears, and there is liquid on the pipe wall, which makes limewater turbid. Ammonium bicarbonate will disappear after long-term exposure to air.

Zn+H2SO4=ZnSO4+H2↑ produces a large number of bubbles, and zinc particles gradually dissolve to prepare hydrogen in the laboratory.

Fe+H2SO4=FeSO4+H2↑ produces a large number of bubbles, and metal particles gradually dissolve.

Mg+H2SO4 =MgSO4+H2↑ produces a large number of bubbles, and metal particles gradually dissolve.

2Al+3H2SO4=Al2(SO4)3+3H2↑ produces a large number of bubbles, and metal particles gradually dissolve.

The red color of Fe2O3+3H2δ 2Fe+3H2O gradually turns silvery white, and there is liquid molten metal on the wall of the test tube, which is reduced by hydrogen.

Fe3O4+4h2δ 3fe+4h2o black gradually turns silvery white, and there is liquid molten metal on the wall of the test tube, which is reduced by hydrogen.

Tungsten smelting by WO3+3H2Δ W +3H2O and reduction by hydrogen.

Molybdenum Smelting with moo 3+3h 2δMo+3H2O and Reduction of Hydrogen

The intense combustion of 2Na+Cl2δδ or the ignition of 2NaCl, the formation of yellow flame ionic compounds,

Ignite with H2+Cl2 or light flame with 2HCl irradiation to form white mist at the bottle mouth, and prepare hydrochloric acid.

CuSO _ 4+2 NaOH = Cu (OH) _ 2 ↓+Na _ 2SO _ 4 There is a blue precipitate of clear solution at the top of the experiment.

The common reaction of 2C +O2 igniting a 2CO coal stove is one of the air pollutants and the cause of gas poisoning.

2C O+O2 ignites 2CO2 blue flame gas for combustion.

At high temperature of C+CuO, 2Cu+ CO2↑ black gradually turns red, and gas is generated to make clear limewater turbid.

2Fe2O3+3C High Temperature 4Fe+ 3CO2↑ Smelting Metal

Fe3O4+2C Melts Metal at the High Temperature of 3Fe+2CO2 =

Carbon+carbon dioxide high temperature carbon dioxide

CO2+H2O = H2CO3 carbonic acid turns litmus red, which proves the acidity of carbonic acid.

H2CO3 δ CO2 ↑+H2O Stalagmite faded.

Ca(OH)2+CO2= CaCO3↓+ H2O clarified limewater becomes turbid. Carbon dioxide detection and lime slurry are used to paint walls.

The white precipitate of CaCO3+H2O+CO2 = Ca(HCO3)2 gradually dissolves the formation of caves and the weathering of stones.

Ca (HCO _ 3) 2 δ CaCO _ 3 ↓+H2O+CO2 ↑ white precipitate, forming gas scale, which makes the clarified lime water turbid. Stalactite formation

2 nah co 3δna2co 3+H2O+CO2↑ gas baking soda steamed bread makes the clear limewater turbid.

Industrial preparation of carbon dioxide and quicklime with CaCO3 and CaO+ CO2 at high temperature.

CaCO3+2HCl=CaCl2+ H2O+CO2↑ Solids are gradually dissolved, which makes the clarified limewater turbid and used for preparing carbon dioxide and removing scale in the laboratory.

Author: Wang Dong3684 2005-12-310: 08 Reply to this speech.

-

4. Comprehensive set of chemical equations in Grade Three-Require refinement

Na2CO3+H2SO4=Na2SO4+H2O+CO2↑ The solid gradually dissolves, and the gas foam extinguisher principle makes the clarified limewater turbid.

Na2CO3+2HCl=2NaCl+ H2O+CO2↑ The solid gradually dissolves, and the gas foam extinguisher principle makes the clarified limewater turbid.

MgCO3+2HCl=MgCl2+H2O+CO2↑ The solid gradually dissolves, and the clarified limewater is turbid with gas.

CuO+coδCu+CO2 black turns red gradually, which leads to gas melting metal making clear limewater turbid.

Principle of high temperature smelting metal with Fe2O3+3CO and 2Fe+3CO2.

Principle of high temperature smelting metal with Fe3O4+4CO and 3Fe+4CO2.

Principle of metal smelting with WO3+3CO and high temperature tungsten +3CO2.

CH3COOH+NaOH=CH3COONa+H2O

2CH3OH+3O2 ignites 2CO2+4H2O.

C2H5OH+3O2 ignites the blue flame of 2CO2+3H2O, producing gas that makes limewater turbid, releasing heat to burn alcohol.

The silvery white metal of Fe+CuSO _ 4 = Cu+FeSO _ 4 is covered with a layer of red substance, which is used for copper hydrometallurgy and copper plating.

The solution of Mg+FeSO4= Fe+ MgSO4 changed from light green to colorless Cu+Hg(NO3)2=Hg+ Cu (NO3)2.

The red metal surface of Cu+2AgNO3=2Ag+ Cu(NO3)2 is covered with a layer of silver-white material.

The blue-white metal surface of Zn+CuSO4= Cu+ZnSO4 is covered with a layer of red substance copper plating.

Fe2O3+6HCl=2FeCl3+3H2O rust dissolves and the solution is yellow.

Al2O3+6HCl=2AlCl3+3H2O white solid dissolved.

Na2O+2hcl = 2ncl+H2O white solid dissolved.

CuO+2HCl=CuCl2+H2O black solid is dissolved, and the solution is blue.

ZnO+2HCl=ZnCl2+ H2O white solid dissolved.

MgO+2HCl=MgCl2+ H2O white solid dissolved.

CaO+2HCl=CaCl2+ H2O white solid dissolved.

NaOH+HCl=NaCl+ H2O white solid dissolved.

Cu(OH)2+2HCl=CuCl2+2H2O blue solid dissolved.

Mg(OH)2+2HCl=MgCl2+2H2O white solid dissolved.

Treatment of hyperacidity with aluminum hydroxide+hydrochloric acid = aluminum trichloride +3H2O white solid dissolving weishuping.

Fe(OH)3+3HCl=FeCl3+3H2O red-brown precipitate is dissolved, and the solution is yellow.

Calcium hydroxide+dihydrochloride = calcium chloride+dihydrate

HCl+AgNO3= AgCl↓+HNO3 generates white precipitate, which is insoluble in dilute nitric acid.

Fe2O3+3H2SO4= Fe2(SO4)3+3H2O rust is dissolved, and the solution is yellow, which is used for rust removal.

Al2O3+3H2SO4= Al2(SO4)3+3H2O white solid dissolved.

CuO+H2SO4=CuSO4+H2O black solid is dissolved, and the solution is blue.

ZnO+H2SO4=ZnSO4+H2O white solid dissolved.

MgO+h2so 4 = magnesium sulfate +H2O white solid dissolved.

2NaOH+H2SO4=Na2SO4+2H2O

Cu(OH)2+H2SO4=CuSO4+2H2O blue solid dissolved.

Calcium hydroxide+sulfuric acid = calcium sulfate +2H2O

Mg(OH)2+H2SO4=MgSO4+2H2O white solid dissolved.

2Al(OH)3+3H2SO4=Al2(SO4)3+3H2O white solid dissolved.

2Fe(OH)3+3H2SO4=Fe2(SO4)3+3H2O red-brown precipitate dissolved, and the solution was yellow.

Ba(OH)2+ H2SO4=BaSO4↓+2H2O generates white precipitate, which is insoluble in dilute nitric acid.

The principle that BaCl2+ H2SO4=BaSO4↓+2HCl generates white precipitate and is insoluble in dilute nitric acid is used to test SO4-.

Ba(NO3)2+H2SO4=BaSO4↓+2HNO3 generates white precipitate, which is insoluble in dilute nitric acid.

Na2O+2HNO3=2NaNO3+H2O white solid dissolved.

CuO+2HNO3=Cu(NO3)2+H2O black solid is dissolved, and the solution is blue.

Dissolve ZnO+2HNO3=Zn(NO3)2+ H2O white solid.

MgO+2HNO3=Mg(NO3)2+ H2O white solid dissolved.

CaO+2HNO3=Ca(NO3)2+ H2O white solid dissolved.

Sodium hydroxide+nitric acid = sodium nitrite+H2O

Cu(OH)2+2HNO3=Cu(NO3)2+2H2O blue solid dissolved.

Mg(OH)2+2HNO3=Mg(NO3)2+2H2O white solid dissolved.

Al(OH)3+3HNO3=Al(NO3)3+3H2O white solid dissolved.

Ca(OH)2+2HNO3=Ca(NO3)2+2H2O

Fe(OH)3+3HNO3=Fe(NO3)3+3H2O red-brown precipitate is dissolved, and the solution is yellow.

3NaOH + H3PO4=3H2O + Na3PO4

3NH3+H3PO4=(NH4)3PO4

2NaOH+CO2=Na2CO3+ H2O absorbs CO2 in CO, O2 and H2,

2 NaOH+SO2 = Na2SO3+H2O2 NaOH+SO3 = Na2SO4+H2O to treat the tail gas (SO2) from sulfuric acid plant.

The NaCl solution of FeCl _ 3+3 NaOH = Fe (OH) _ 3 ↓+3 faded yellow and formed reddish-brown precipitate.

White precipitate was formed in AlCl3+3NaOH=Al(OH)3↓+3NaCl.

Magnesium chloride +2 sodium hydroxide = magnesium hydroxide ↓+2 sodium chloride

The blue color of CuCl _ 2+2 NaOH = Cu (OH) _ 2 ↓+2 NaCl solution faded and blue precipitate was formed.

CaO+ H2O = Ca(OH)2 white block solid is turned into powder, and lime slurry is prepared with quicklime.

Ca(OH)2+SO2=CaSO3↓+ H2O with white precipitate is generally not used in junior high schools.

Ca(OH)2+Na2CO3=CaCO3↓+2NaOH has white precipitation to produce industrial caustic soda, and a small amount of caustic soda is produced in the laboratory.

Ba(OH)2+Na2CO3=BaCO3↓+2NaOH has white precipitate.

Ca(OH)2+K2CO3=CaCO3↓ +2KOH has white precipitate.

CuSO4+5H2O= CuSO4 H2O H2O blue crystal becomes white powder.

CuSO4 H2O δ CuSO4+5h2o white powder turns blue to test whether there is water in the substance.

AgNO3+NaCl = AgCl↓+Na NO3 white insoluble in dilute nitric acid precipitation (similar reaction of other chlorides) is used to test chloride ions in solution.

BaCl2+Na2SO4 = BaSO4↓+2NaCl white insoluble in dilute nitric acid (other sulfate-like reactions) is used to test sulfate ions.

White precipitate is formed in CaCl _ 2+na2co _ 3 = CaCO _ 3↓+2 NaCl.

MgCl2+Ba(OH)2=BaCl2+Mg(OH)2↓

Calcium carbonate+hydrochloric acid = calcium chloride +H2O+ carbon dioxide

Magnesium carbonate+hydrochloric acid = magnesium chloride +H2O+ carbon dioxide

NH4NO3+NaOH=NaNO3+NH3↑+H2O produces a gas that turns wet litmus paper blue and is used to test ammonium ions in solution.

NH4Cl+ KOH= KCl+NH3↑+H2O produces a gas that turns wet litmus paper blue.